C16H16F2O2 — CID 116789730
1-[3-(2,2-difluoro-2-phenylethoxy)phenyl]ethanol (PubChem CID 116789730) has the molecular formula C16H16F2O2 and a molecular weight of 278.30 g/mol. Its IUPAC name is 1-[3-(2,2-difluoro-2-phenylethoxy)phenyl]ethanol.
| Compound Name | 1-[3-(2,2-difluoro-2-phenylethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 116789730 |
| Molecular Formula | C16H16F2O2 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-[3-(2,2-difluoro-2-phenylethoxy)phenyl]ethanol |
| SMILES | CC(O)c1cccc(OCC(F)(F)c2ccccc2)c1 |
| InChI | InChI=1S/C16H16F2O2/c1-12(19)13-6-5-9-15(10-13)20-11-16(17,18)14-7-3-2-4-8-14/h2-10,12,19H,11H2,1H3 |
| InChIKey | HHHGSGPREITWFR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |