C16H19F2NO — CID 116790132
1-[1-(2,2-difluoro-2-phenylethyl)pyrrol-3-yl]butan-1-ol (PubChem CID 116790132) has the molecular formula C16H19F2NO and a molecular weight of 279.33 g/mol. Its IUPAC name is 1-[1-(2,2-difluoro-2-phenylethyl)pyrrol-3-yl]butan-1-ol.
| Compound Name | 1-[1-(2,2-difluoro-2-phenylethyl)pyrrol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 116790132 |
| Molecular Formula | C16H19F2NO |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 1-[1-(2,2-difluoro-2-phenylethyl)pyrrol-3-yl]butan-1-ol |
| SMILES | CCCC(O)c1ccn(CC(F)(F)c2ccccc2)c1 |
| InChI | InChI=1S/C16H19F2NO/c1-2-6-15(20)13-9-10-19(11-13)12-16(17,18)14-7-4-3-5-8-14/h3-5,7-11,15,20H,2,6,12H2,1H3 |
| InChIKey | YBRWIGPDUGLBAJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |