C15H18ClNO — CID 79109675
1-[1-[(2-chlorophenyl)methyl]pyrrol-3-yl]butan-1-ol (PubChem CID 79109675) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is 1-[1-[(2-chlorophenyl)methyl]pyrrol-3-yl]butan-1-ol.
| Compound Name | 1-[1-[(2-chlorophenyl)methyl]pyrrol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 79109675 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-[1-[(2-chlorophenyl)methyl]pyrrol-3-yl]butan-1-ol |
| SMILES | CCCC(O)c1ccn(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H18ClNO/c1-2-5-15(18)13-8-9-17(11-13)10-12-6-3-4-7-14(12)16/h3-4,6-9,11,15,18H,2,5,10H2,1H3 |
| InChIKey | GNSHBOMBWMEETG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |