C14H12F3NOS — CID 116790944
3-(2,2-difluoro-2-phenylethyl)sulfinyl-5-fluoroaniline (PubChem CID 116790944) has the molecular formula C14H12F3NOS and a molecular weight of 299.32 g/mol. Its IUPAC name is 3-(2,2-difluoro-2-phenylethyl)sulfinyl-5-fluoroaniline.
| Compound Name | 3-(2,2-difluoro-2-phenylethyl)sulfinyl-5-fluoroaniline |
|---|---|
| PubChem CID | 116790944 |
| Molecular Formula | C14H12F3NOS |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-(2,2-difluoro-2-phenylethyl)sulfinyl-5-fluoroaniline |
| SMILES | Nc1cc(F)cc(S(=O)CC(F)(F)c2ccccc2)c1 |
| InChI | InChI=1S/C14H12F3NOS/c15-11-6-12(18)8-13(7-11)20(19)9-14(16,17)10-4-2-1-3-5-10/h1-8H,9,18H2 |
| InChIKey | HDQFJTQDDPOLJV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|