C14H11F3OS — CID 116790723
1-(2,2-difluoro-2-phenylethyl)sulfinyl-2-fluorobenzene (PubChem CID 116790723) has the molecular formula C14H11F3OS and a molecular weight of 284.30 g/mol. Its IUPAC name is 1-(2,2-difluoro-2-phenylethyl)sulfinyl-2-fluorobenzene.
| Compound Name | 1-(2,2-difluoro-2-phenylethyl)sulfinyl-2-fluorobenzene |
|---|---|
| PubChem CID | 116790723 |
| Molecular Formula | C14H11F3OS |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1-(2,2-difluoro-2-phenylethyl)sulfinyl-2-fluorobenzene |
| SMILES | O=S(CC(F)(F)c1ccccc1)c1ccccc1F |
| InChI | InChI=1S/C14H11F3OS/c15-12-8-4-5-9-13(12)19(18)10-14(16,17)11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | YXUYHTNPHYXLBM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |