C11H9NS — CID 116791019
3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-ynenitrile (PubChem CID 116791019) has the molecular formula C11H9NS and a molecular weight of 187.27 g/mol. Its IUPAC name is 3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-ynenitrile.
| Compound Name | 3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-ynenitrile |
|---|---|
| PubChem CID | 116791019 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-ynenitrile |
| SMILES | N#CC#Cc1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C11H9NS/c12-7-3-5-10-8-9-4-1-2-6-11(9)13-10/h8H,1-2,4,6H2 |
| InChIKey | RGHNJCMLIFLNKB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|