C10H20N4O — CID 116793723
N',N'-dimethyl-N-[2-(1-methylpyrazol-4-yl)oxyethyl]ethane-1,2-diamine (PubChem CID 116793723) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(1-methylpyrazol-4-yl)oxyethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(1-methylpyrazol-4-yl)oxyethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 116793723 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | N',N'-dimethyl-N-[2-(1-methylpyrazol-4-yl)oxyethyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCCOc1cnn(C)c1 |
| InChI | InChI=1S/C10H20N4O/c1-13(2)6-4-11-5-7-15-10-8-12-14(3)9-10/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | UZBUTRFOBGQHEM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|