C12H24N4O — CID 116803927
N',N'-dimethyl-N-[2-(1-propan-2-ylpyrazol-4-yl)oxyethyl]ethane-1,2-diamine (PubChem CID 116803927) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(1-propan-2-ylpyrazol-4-yl)oxyethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(1-propan-2-ylpyrazol-4-yl)oxyethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 116803927 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | N',N'-dimethyl-N-[2-(1-propan-2-ylpyrazol-4-yl)oxyethyl]ethane-1,2-diamine |
| SMILES | CC(C)n1cc(OCCNCCN(C)C)cn1 |
| InChI | InChI=1S/C12H24N4O/c1-11(2)16-10-12(9-14-16)17-8-6-13-5-7-15(3)4/h9-11,13H,5-8H2,1-4H3 |
| InChIKey | ZGDCYDFDYFLZMC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|