C10H19N3O3S — CID 116793914
3-methyl-2-[(1-methylpyrazol-4-yl)oxymethyl]butane-1-sulfonamide (PubChem CID 116793914) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-methyl-2-[(1-methylpyrazol-4-yl)oxymethyl]butane-1-sulfonamide.
| Compound Name | 3-methyl-2-[(1-methylpyrazol-4-yl)oxymethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 116793914 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 3-methyl-2-[(1-methylpyrazol-4-yl)oxymethyl]butane-1-sulfonamide |
| SMILES | CC(C)C(COc1cnn(C)c1)CS(N)(=O)=O |
| InChI | InChI=1S/C10H19N3O3S/c1-8(2)9(7-17(11,14)15)6-16-10-4-12-13(3)5-10/h4-5,8-9H,6-7H2,1-3H3,(H2,11,14,15) |
| InChIKey | FVFKUMWPFTZZTJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |