C11H17N5 — CID 116795448
2-N-(1-azabicyclo[2.2.2]octan-3-yl)pyrimidine-2,4-diamine (PubChem CID 116795448) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-N-(1-azabicyclo[2.2.2]octan-3-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(1-azabicyclo[2.2.2]octan-3-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116795448 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-N-(1-azabicyclo[2.2.2]octan-3-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1ccnc(NC2CN3CCC2CC3)n1 |
| InChI | InChI=1S/C11H17N5/c12-10-1-4-13-11(15-10)14-9-7-16-5-2-8(9)3-6-16/h1,4,8-9H,2-3,5-7H2,(H3,12,13,14,15) |
| InChIKey | RUOZBFOLADCAGW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |