C12H20N4 — CID 116795796
2-N-(2-ethylcyclohexyl)pyrimidine-2,4-diamine (PubChem CID 116795796) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-N-(2-ethylcyclohexyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-ethylcyclohexyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116795796 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 2-N-(2-ethylcyclohexyl)pyrimidine-2,4-diamine |
| SMILES | CCC1CCCCC1Nc1nccc(N)n1 |
| InChI | InChI=1S/C12H20N4/c1-2-9-5-3-4-6-10(9)15-12-14-8-7-11(13)16-12/h7-10H,2-6H2,1H3,(H3,13,14,15,16) |
| InChIKey | UJGOHCYVJKCKNV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |