C9H14BrN5 — CID 116796173
6-bromo-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 116796173) has the molecular formula C9H14BrN5 and a molecular weight of 272.15 g/mol. Its IUPAC name is 6-bromo-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | 6-bromo-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116796173 |
| Molecular Formula | C9H14BrN5 |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 6-bromo-2-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | CN1CCN(c2nc(N)cc(Br)n2)CC1 |
| InChI | InChI=1S/C9H14BrN5/c1-14-2-4-15(5-3-14)9-12-7(10)6-8(11)13-9/h6H,2-5H2,1H3,(H2,11,12,13) |
| InChIKey | CKHLGGSDXZHPRS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |