About 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine
2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine (PubChem CID 130320466) has the molecular formula C14H20N8OS
and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine |
| PubChem CID | 130320466 |
| Molecular Formula | C14H20N8OS |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine |
| SMILES | COc1nc(N2CCN(C)CC2)ncc1Sc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C14H20N8OS/c1-21-3-5-22(6-4-21)13-17-8-9(12(20-13)23-2)24-14-18-10(15)7-11(16)19-14/h7-8H,3-6H2,1-2H3,(H4,15,16,18,19) |
| InChIKey | MIAIKWYNTKMWEU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine?
The IUPAC name of 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine (CID 130320466) is 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine.
What is the SMILES notation for 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine?
The canonical SMILES for 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine is COc1nc(N2CCN(C)CC2)ncc1Sc1nc(N)cc(N)n1.
What is the InChIKey of 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine?
The InChIKey is MIAIKWYNTKMWEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N8OS/c1-21-3-5-22(6-4-21)13-17-8-9(12(20-13)23-2)24-14-18-10(15)7-11(16)19-14/h7-8H,3-6H2,1-2H3,(H4,15,16,18,19).
What are the key properties of 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine?
2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine has a molecular weight of 348.44 g/mol, XLogP of 0.34, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidine-4,6-diamine is sourced from PubChem (CID 130320466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).