C23H23ClN4O2S — CID 118515256
4-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]sulfanylbenzoyl chloride (PubChem CID 118515256) has the molecular formula C23H23ClN4O2S and a molecular weight of 454.98 g/mol. Its IUPAC name is 4-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]sulfanylbenzoyl chloride.
| Compound Name | 4-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]sulfanylbenzoyl chloride |
|---|---|
| PubChem CID | 118515256 |
| Molecular Formula | C23H23ClN4O2S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 4-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]sulfanylbenzoyl chloride |
| SMILES | CN1CCN(c2ncc(Sc3ccc(C(=O)Cl)cc3)c(OCc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C23H23ClN4O2S/c1-27-11-13-28(14-12-27)23-25-15-20(31-19-9-7-18(8-10-19)21(24)29)22(26-23)30-16-17-5-3-2-4-6-17/h2-10,15H,11-14,16H2,1H3 |
| InChIKey | AQEYKXSRELCTKN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|