C25H29IN6O2S — CID 163697060
4-[4-[[3-(dimethylamino)phenyl]methoxy]-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanyl-2-iodobenzamide (PubChem CID 163697060) has the molecular formula C25H29IN6O2S and a molecular weight of 604.52 g/mol. Its IUPAC name is 4-[4-[[3-(dimethylamino)phenyl]methoxy]-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanyl-2-iodobenzamide.
| Compound Name | 4-[4-[[3-(dimethylamino)phenyl]methoxy]-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanyl-2-iodobenzamide |
|---|---|
| PubChem CID | 163697060 |
| Molecular Formula | C25H29IN6O2S |
| Molecular Weight | 604.52 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | 4-[4-[[3-(dimethylamino)phenyl]methoxy]-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanyl-2-iodobenzamide |
| SMILES | CN1CCN(c2ncc(Sc3ccc(C(N)=O)c(I)c3)c(OCc3cccc(N(C)C)c3)n2)CC1 |
| InChI | InChI=1S/C25H29IN6O2S/c1-30(2)18-6-4-5-17(13-18)16-34-24-22(35-19-7-8-20(23(27)33)21(26)14-19)15-28-25(29-24)32-11-9-31(3)10-12-32/h4-8,13-15H,9-12,16H2,1-3H3,(H2,27,33) |
| InChIKey | JXUZBBRLMJZFFB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|