C23H25N5O2S — CID 118515033
3-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]sulfanylbenzamide (PubChem CID 118515033) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is 3-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]sulfanylbenzamide.
| Compound Name | 3-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]sulfanylbenzamide |
|---|---|
| PubChem CID | 118515033 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]sulfanylbenzamide |
| SMILES | CN1CCN(c2ncc(Sc3cccc(C(N)=O)c3)c(OCc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C23H25N5O2S/c1-27-10-12-28(13-11-27)23-25-15-20(31-19-9-5-8-18(14-19)21(24)29)22(26-23)30-16-17-6-3-2-4-7-17/h2-9,14-15H,10-13,16H2,1H3,(H2,24,29) |
| InChIKey | QZPOBBHHBVPZSI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |