C25H28N4O3 — CID 123174913
4-[2-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]ethyl]benzoic acid (PubChem CID 123174913) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 4-[2-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 123174913 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 4-[2-[2-(4-methylpiperazin-1-yl)-4-phenylmethoxypyrimidin-5-yl]ethyl]benzoic acid |
| SMILES | CN1CCN(c2ncc(CCc3ccc(C(=O)O)cc3)c(OCc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C25H28N4O3/c1-28-13-15-29(16-14-28)25-26-17-22(12-9-19-7-10-21(11-8-19)24(30)31)23(27-25)32-18-20-5-3-2-4-6-20/h2-8,10-11,17H,9,12-16,18H2,1H3,(H,30,31) |
| InChIKey | FDFJHXBENRHGTI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |