C6H9BrN4 — CID 116796338
6-bromo-2-N,2-N-dimethylpyrimidine-2,4-diamine (PubChem CID 116796338) has the molecular formula C6H9BrN4 and a molecular weight of 217.07 g/mol. Its IUPAC name is 6-bromo-2-N,2-N-dimethylpyrimidine-2,4-diamine.
| Compound Name | 6-bromo-2-N,2-N-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116796338 |
| Molecular Formula | C6H9BrN4 |
| Molecular Weight | 217.07 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 6-bromo-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1nc(N)cc(Br)n1 |
| InChI | InChI=1S/C6H9BrN4/c1-11(2)6-9-4(7)3-5(8)10-6/h3H,1-2H3,(H2,8,9,10) |
| InChIKey | KGBNYHFXYDUAIA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.07 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |