C7H11BrN4 — CID 116796401
6-bromo-2-N-ethyl-2-N-methylpyrimidine-2,4-diamine (PubChem CID 116796401) has the molecular formula C7H11BrN4 and a molecular weight of 231.10 g/mol. Its IUPAC name is 6-bromo-2-N-ethyl-2-N-methylpyrimidine-2,4-diamine.
| Compound Name | 6-bromo-2-N-ethyl-2-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116796401 |
| Molecular Formula | C7H11BrN4 |
| Molecular Weight | 231.10 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 6-bromo-2-N-ethyl-2-N-methylpyrimidine-2,4-diamine |
| SMILES | CCN(C)c1nc(N)cc(Br)n1 |
| InChI | InChI=1S/C7H11BrN4/c1-3-12(2)7-10-5(8)4-6(9)11-7/h4H,3H2,1-2H3,(H2,9,10,11) |
| InChIKey | XLNIMJKOYGJEDU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.10 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |