C16H15BrN4 — CID 116796276
6-bromo-2-N-ethyl-2-N-naphthalen-1-ylpyrimidine-2,4-diamine (PubChem CID 116796276) has the molecular formula C16H15BrN4 and a molecular weight of 343.23 g/mol. Its IUPAC name is 6-bromo-2-N-ethyl-2-N-naphthalen-1-ylpyrimidine-2,4-diamine.
| Compound Name | 6-bromo-2-N-ethyl-2-N-naphthalen-1-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116796276 |
| Molecular Formula | C16H15BrN4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 6-bromo-2-N-ethyl-2-N-naphthalen-1-ylpyrimidine-2,4-diamine |
| SMILES | CCN(c1nc(N)cc(Br)n1)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H15BrN4/c1-2-21(16-19-14(17)10-15(18)20-16)13-9-5-7-11-6-3-4-8-12(11)13/h3-10H,2H2,1H3,(H2,18,19,20) |
| InChIKey | POYNBYUCZKFJLU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |