C13H20N4 — CID 116796481
2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pyrimidin-4-amine (PubChem CID 116796481) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pyrimidin-4-amine.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116796481 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pyrimidin-4-amine |
| SMILES | Nc1ccnc(N2CCCC3CCCCC32)n1 |
| InChI | InChI=1S/C13H20N4/c14-12-7-8-15-13(16-12)17-9-3-5-10-4-1-2-6-11(10)17/h7-8,10-11H,1-6,9H2,(H2,14,15,16) |
| InChIKey | MFUIQXHOQAPDTO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |