C12H21N5 — CID 114088533
2-(2-ethyl-4-methyl-1,4-diazepan-1-yl)pyrimidin-4-amine (PubChem CID 114088533) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(2-ethyl-4-methyl-1,4-diazepan-1-yl)pyrimidin-4-amine.
| Compound Name | 2-(2-ethyl-4-methyl-1,4-diazepan-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114088533 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 2-(2-ethyl-4-methyl-1,4-diazepan-1-yl)pyrimidin-4-amine |
| SMILES | CCC1CN(C)CCCN1c1nccc(N)n1 |
| InChI | InChI=1S/C12H21N5/c1-3-10-9-16(2)7-4-8-17(10)12-14-6-5-11(13)15-12/h5-6,10H,3-4,7-9H2,1-2H3,(H2,13,14,15) |
| InChIKey | GQOKZHYSQHRLRF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |