C11H16N4S — CID 107546728
2-(2-ethylpyrrolidin-1-yl)pyrimidine-4-carbothioamide (PubChem CID 107546728) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-(2-ethylpyrrolidin-1-yl)pyrimidine-4-carbothioamide.
| Compound Name | 2-(2-ethylpyrrolidin-1-yl)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107546728 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-(2-ethylpyrrolidin-1-yl)pyrimidine-4-carbothioamide |
| SMILES | CCC1CCCN1c1nccc(C(N)=S)n1 |
| InChI | InChI=1S/C11H16N4S/c1-2-8-4-3-7-15(8)11-13-6-5-9(14-11)10(12)16/h5-6,8H,2-4,7H2,1H3,(H2,12,16) |
| InChIKey | ROPJAXJRORKTDM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|