C11H15N5OS — CID 107547470
2-(2-ethyl-3-oxopiperazin-1-yl)pyrimidine-4-carbothioamide (PubChem CID 107547470) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-(2-ethyl-3-oxopiperazin-1-yl)pyrimidine-4-carbothioamide.
| Compound Name | 2-(2-ethyl-3-oxopiperazin-1-yl)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547470 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-(2-ethyl-3-oxopiperazin-1-yl)pyrimidine-4-carbothioamide |
| SMILES | CCC1C(=O)NCCN1c1nccc(C(N)=S)n1 |
| InChI | InChI=1S/C11H15N5OS/c1-2-8-10(17)13-5-6-16(8)11-14-4-3-7(15-11)9(12)18/h3-4,8H,2,5-6H2,1H3,(H2,12,18)(H,13,17) |
| InChIKey | VOWJOAFASJOPOH-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|