C14H22IN3 — CID 114086195
4-(2-ethyl-4-methyl-1,4-diazepan-1-yl)-3-iodoaniline (PubChem CID 114086195) has the molecular formula C14H22IN3 and a molecular weight of 359.26 g/mol. Its IUPAC name is 4-(2-ethyl-4-methyl-1,4-diazepan-1-yl)-3-iodoaniline.
| Compound Name | 4-(2-ethyl-4-methyl-1,4-diazepan-1-yl)-3-iodoaniline |
|---|---|
| PubChem CID | 114086195 |
| Molecular Formula | C14H22IN3 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-(2-ethyl-4-methyl-1,4-diazepan-1-yl)-3-iodoaniline |
| SMILES | CCC1CN(C)CCCN1c1ccc(N)cc1I |
| InChI | InChI=1S/C14H22IN3/c1-3-12-10-17(2)7-4-8-18(12)14-6-5-11(16)9-13(14)15/h5-6,9,12H,3-4,7-8,10,16H2,1-2H3 |
| InChIKey | CCKNHDPDXRTSPJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|