C14H21IN2 — CID 114591976
3-iodo-4-(2,3,5-trimethylpiperidin-1-yl)aniline (PubChem CID 114591976) has the molecular formula C14H21IN2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 3-iodo-4-(2,3,5-trimethylpiperidin-1-yl)aniline.
| Compound Name | 3-iodo-4-(2,3,5-trimethylpiperidin-1-yl)aniline |
|---|---|
| PubChem CID | 114591976 |
| Molecular Formula | C14H21IN2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 3-iodo-4-(2,3,5-trimethylpiperidin-1-yl)aniline |
| SMILES | CC1CC(C)C(C)N(c2ccc(N)cc2I)C1 |
| InChI | InChI=1S/C14H21IN2/c1-9-6-10(2)11(3)17(8-9)14-5-4-12(16)7-13(14)15/h4-5,7,9-11H,6,8,16H2,1-3H3 |
| InChIKey | MBOILVXVCWJAOF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|