methyl 2-(1-ethylpyrazol-4-yl)oxyacetate

C8H12N2O3 — CID 116800028

IUPACmethyl 2-(1-ethylpyrazol-4-yl)oxyacetate
SMILESCCn1cc(OCC(=O)OC)cn1
InChIInChI=1S/C8H12N2O3/c1-3-10-5-7(4-9-10)13-6-8(11)12-2/h4-5H,3,6H2,1-2H3
InChIKeyGHMDIOIFSFYDEE-UHFFFAOYSA-N
MW184.19 g/mol
LogP0.45
Rot. Bonds4

About methyl 2-(1-ethylpyrazol-4-yl)oxyacetate

methyl 2-(1-ethylpyrazol-4-yl)oxyacetate (PubChem CID 116800028) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is methyl 2-(1-ethylpyrazol-4-yl)oxyacetate.

Molecular Properties

Compound Namemethyl 2-(1-ethylpyrazol-4-yl)oxyacetate
PubChem CID116800028
Molecular FormulaC8H12N2O3
Molecular Weight184.19 g/mol
Exact Mass184.08
IUPAC Namemethyl 2-(1-ethylpyrazol-4-yl)oxyacetate
SMILESCCn1cc(OCC(=O)OC)cn1
InChIInChI=1S/C8H12N2O3/c1-3-10-5-7(4-9-10)13-6-8(11)12-2/h4-5H,3,6H2,1-2H3
InChIKeyGHMDIOIFSFYDEE-UHFFFAOYSA-N
XLogP0.45
TPSA53.35 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 50.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(1-ethylpyrazol-4-yl)oxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1-ethylpyrazol-4-yl)oxyacetate?
The IUPAC name of methyl 2-(1-ethylpyrazol-4-yl)oxyacetate (CID 116800028) is methyl 2-(1-ethylpyrazol-4-yl)oxyacetate.
What is the SMILES notation for methyl 2-(1-ethylpyrazol-4-yl)oxyacetate?
The canonical SMILES for methyl 2-(1-ethylpyrazol-4-yl)oxyacetate is CCn1cc(OCC(=O)OC)cn1.
What is the InChIKey of methyl 2-(1-ethylpyrazol-4-yl)oxyacetate?
The InChIKey is GHMDIOIFSFYDEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-3-10-5-7(4-9-10)13-6-8(11)12-2/h4-5H,3,6H2,1-2H3.
What are the key properties of methyl 2-(1-ethylpyrazol-4-yl)oxyacetate?
methyl 2-(1-ethylpyrazol-4-yl)oxyacetate has a molecular weight of 184.19 g/mol, XLogP of 0.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-ethylpyrazol-4-yl)oxyacetate is sourced from PubChem (CID 116800028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).