C12H11F3N4OS — CID 116801325
2-(1-ethylpyrazol-4-yl)oxy-6-(trifluoromethyl)pyridine-3-carbothioamide (PubChem CID 116801325) has the molecular formula C12H11F3N4OS and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)oxy-6-(trifluoromethyl)pyridine-3-carbothioamide.
| Compound Name | 2-(1-ethylpyrazol-4-yl)oxy-6-(trifluoromethyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 116801325 |
| Molecular Formula | C12H11F3N4OS |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)oxy-6-(trifluoromethyl)pyridine-3-carbothioamide |
| SMILES | CCn1cc(Oc2nc(C(F)(F)F)ccc2C(N)=S)cn1 |
| InChI | InChI=1S/C12H11F3N4OS/c1-2-19-6-7(5-17-19)20-11-8(10(16)21)3-4-9(18-11)12(13,14)15/h3-6H,2H2,1H3,(H2,16,21) |
| InChIKey | QPKXWTMDPSLJMF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|