C9H9Cl2N3OS — CID 116802045
4-chloro-5-(chloromethyl)-2-(1-ethylpyrazol-4-yl)oxy-1,3-thiazole (PubChem CID 116802045) has the molecular formula C9H9Cl2N3OS and a molecular weight of 278.16 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-2-(1-ethylpyrazol-4-yl)oxy-1,3-thiazole.
| Compound Name | 4-chloro-5-(chloromethyl)-2-(1-ethylpyrazol-4-yl)oxy-1,3-thiazole |
|---|---|
| PubChem CID | 116802045 |
| Molecular Formula | C9H9Cl2N3OS |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-2-(1-ethylpyrazol-4-yl)oxy-1,3-thiazole |
| SMILES | CCn1cc(Oc2nc(Cl)c(CCl)s2)cn1 |
| InChI | InChI=1S/C9H9Cl2N3OS/c1-2-14-5-6(4-12-14)15-9-13-8(11)7(3-10)16-9/h4-5H,2-3H2,1H3 |
| InChIKey | ABAGUMNZPZGUKA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|