C12H11NO4 — CID 11680250
3-[benzyl(hydroxy)amino]-4-methoxycyclobut-3-ene-1,2-dione (PubChem CID 11680250) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 3-[benzyl(hydroxy)amino]-4-methoxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[benzyl(hydroxy)amino]-4-methoxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11680250 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-[benzyl(hydroxy)amino]-4-methoxycyclobut-3-ene-1,2-dione |
| SMILES | COc1c(N(O)Cc2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C12H11NO4/c1-17-12-9(10(14)11(12)15)13(16)7-8-5-3-2-4-6-8/h2-6,16H,7H2,1H3 |
| InChIKey | IAEZHICPYJRGRD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|