C11H10NO3- — CID 135044024
3-(cyclopenta-1,3-dien-1-ylmethylamino)-4-methoxycyclobut-3-ene-1,2-dione (PubChem CID 135044024) has the molecular formula C11H10NO3- and a molecular weight of 204.21 g/mol. Its IUPAC name is 3-(cyclopenta-1,3-dien-1-ylmethylamino)-4-methoxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-(cyclopenta-1,3-dien-1-ylmethylamino)-4-methoxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 135044024 |
| Molecular Formula | C11H10NO3- |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-(cyclopenta-1,3-dien-1-ylmethylamino)-4-methoxycyclobut-3-ene-1,2-dione |
| SMILES | COc1c(NCc2ccc[cH-]2)c(=O)c1=O |
| InChI | InChI=1S/C11H10NO3/c1-15-11-8(9(13)10(11)14)12-6-7-4-2-3-5-7/h2-5,12H,6H2,1H3/q-1 |
| InChIKey | YUPLUKIIBBBJFD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|