C11H17N7O2 — CID 116806821
[4-(1-ethylpyrazol-4-yl)oxy-6-propoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 116806821) has the molecular formula C11H17N7O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is [4-(1-ethylpyrazol-4-yl)oxy-6-propoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(1-ethylpyrazol-4-yl)oxy-6-propoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 116806821 |
| Molecular Formula | C11H17N7O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | [4-(1-ethylpyrazol-4-yl)oxy-6-propoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCCOc1nc(NN)nc(Oc2cnn(CC)c2)n1 |
| InChI | InChI=1S/C11H17N7O2/c1-3-5-19-10-14-9(17-12)15-11(16-10)20-8-6-13-18(4-2)7-8/h6-7H,3-5,12H2,1-2H3,(H,14,15,16,17) |
| InChIKey | PVAYXQUKWXJVEN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|