C12H13FN4O2 — CID 116807492
2-fluoro-5-(3-morpholin-4-yl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 116807492) has the molecular formula C12H13FN4O2 and a molecular weight of 264.26 g/mol. Its IUPAC name is 2-fluoro-5-(3-morpholin-4-yl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | 2-fluoro-5-(3-morpholin-4-yl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 116807492 |
| Molecular Formula | C12H13FN4O2 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-fluoro-5-(3-morpholin-4-yl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | Nc1cc(-c2nc(N3CCOCC3)no2)ccc1F |
| InChI | InChI=1S/C12H13FN4O2/c13-9-2-1-8(7-10(9)14)11-15-12(16-19-11)17-3-5-18-6-4-17/h1-2,7H,3-6,14H2 |
| InChIKey | OWSSIMCHMQDZTK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|