About 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid
2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid (PubChem CID 116808687) has the molecular formula C7H11N3O3
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid.
Analyze 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid?
The IUPAC name of 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid (CID 116808687) is 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid?
The canonical SMILES for 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid is CCN(C)c1noc(CC(=O)O)n1.
What is the InChIKey of 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid?
The InChIKey is DFGCXCGQPAHKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3/c1-3-10(2)7-8-5(13-9-7)4-6(11)12/h3-4H2,1-2H3,(H,11,12).
What are the key properties of 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid?
2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid has a molecular weight of 185.18 g/mol, XLogP of 0.15, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[ethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]acetic acid is sourced from PubChem (CID 116808687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).