C5H5N3O4 — CID 142811350
2-(3-formamido-1,2,4-oxadiazol-5-yl)acetic acid (PubChem CID 142811350) has the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. Its IUPAC name is 2-(3-formamido-1,2,4-oxadiazol-5-yl)acetic acid.
| Compound Name | 2-(3-formamido-1,2,4-oxadiazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 142811350 |
| Molecular Formula | C5H5N3O4 |
| Molecular Weight | 171.11 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | 2-(3-formamido-1,2,4-oxadiazol-5-yl)acetic acid |
| SMILES | O=CNc1noc(CC(=O)O)n1 |
| InChI | InChI=1S/C5H5N3O4/c9-2-6-5-7-3(12-8-5)1-4(10)11/h2H,1H2,(H,10,11)(H,6,8,9) |
| InChIKey | BYIVGJBXVKOPAJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.11 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|