C7H8N2O3S — CID 84669424
2-[3-(thietan-3-yl)-1,2,4-oxadiazol-5-yl]acetic acid (PubChem CID 84669424) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is 2-[3-(thietan-3-yl)-1,2,4-oxadiazol-5-yl]acetic acid.
| Compound Name | 2-[3-(thietan-3-yl)-1,2,4-oxadiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 84669424 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 2-[3-(thietan-3-yl)-1,2,4-oxadiazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1nc(C2CSC2)no1 |
| InChI | InChI=1S/C7H8N2O3S/c10-6(11)1-5-8-7(9-12-5)4-2-13-3-4/h4H,1-3H2,(H,10,11) |
| InChIKey | PPOQNPFSINWPNC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |