C13H20N2O3 — CID 65422885
2-[3-(4-propylcyclohexyl)-1,2,4-oxadiazol-5-yl]acetic acid (PubChem CID 65422885) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[3-(4-propylcyclohexyl)-1,2,4-oxadiazol-5-yl]acetic acid.
| Compound Name | 2-[3-(4-propylcyclohexyl)-1,2,4-oxadiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 65422885 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-[3-(4-propylcyclohexyl)-1,2,4-oxadiazol-5-yl]acetic acid |
| SMILES | CCCC1CCC(c2noc(CC(=O)O)n2)CC1 |
| InChI | InChI=1S/C13H20N2O3/c1-2-3-9-4-6-10(7-5-9)13-14-11(18-15-13)8-12(16)17/h9-10H,2-8H2,1H3,(H,16,17) |
| InChIKey | GFABRNMHDFVXAG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |