C14H21FN2O — CID 116812956
N-(3-ethoxy-2-ethyl-2-methylcyclobutyl)-6-fluoropyridin-2-amine (PubChem CID 116812956) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is N-(3-ethoxy-2-ethyl-2-methylcyclobutyl)-6-fluoropyridin-2-amine.
| Compound Name | N-(3-ethoxy-2-ethyl-2-methylcyclobutyl)-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 116812956 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-(3-ethoxy-2-ethyl-2-methylcyclobutyl)-6-fluoropyridin-2-amine |
| SMILES | CCOC1CC(Nc2cccc(F)n2)C1(C)CC |
| InChI | InChI=1S/C14H21FN2O/c1-4-14(3)10(9-11(14)18-5-2)16-13-8-6-7-12(15)17-13/h6-8,10-11H,4-5,9H2,1-3H3,(H,16,17) |
| InChIKey | CMMGRRGMIBZBOT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|