C15H21Cl2NO — CID 65467782
2,6-dichloro-N-(3-ethoxy-2-ethyl-2-methylcyclobutyl)aniline (PubChem CID 65467782) has the molecular formula C15H21Cl2NO and a molecular weight of 302.24 g/mol. Its IUPAC name is 2,6-dichloro-N-(3-ethoxy-2-ethyl-2-methylcyclobutyl)aniline.
| Compound Name | 2,6-dichloro-N-(3-ethoxy-2-ethyl-2-methylcyclobutyl)aniline |
|---|---|
| PubChem CID | 65467782 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2,6-dichloro-N-(3-ethoxy-2-ethyl-2-methylcyclobutyl)aniline |
| SMILES | CCOC1CC(Nc2c(Cl)cccc2Cl)C1(C)CC |
| InChI | InChI=1S/C15H21Cl2NO/c1-4-15(3)12(9-13(15)19-5-2)18-14-10(16)7-6-8-11(14)17/h6-8,12-13,18H,4-5,9H2,1-3H3 |
| InChIKey | USRMMXQAKRFYNH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |