C13H20FN3O — CID 116813224
3-(aminomethyl)-N-(6-fluoro-2-pyridinyl)-5-methylhexanamide (PubChem CID 116813224) has the molecular formula C13H20FN3O and a molecular weight of 253.32 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(6-fluoro-2-pyridinyl)-5-methylhexanamide.
| Compound Name | 3-(aminomethyl)-N-(6-fluoro-2-pyridinyl)-5-methylhexanamide |
|---|---|
| PubChem CID | 116813224 |
| Molecular Formula | C13H20FN3O |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 3-(aminomethyl)-N-(6-fluoro-2-pyridinyl)-5-methylhexanamide |
| SMILES | CC(C)CC(CN)CC(=O)Nc1cccc(F)n1 |
| InChI | InChI=1S/C13H20FN3O/c1-9(2)6-10(8-15)7-13(18)17-12-5-3-4-11(14)16-12/h3-5,9-10H,6-8,15H2,1-2H3,(H,16,17,18) |
| InChIKey | NTQBSRWZBUHGLC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|