C14H21BrN2O2 — CID 81496704
(3S)-3-(aminomethyl)-N-(3-bromo-2-hydroxyphenyl)-5-methylhexanamide (PubChem CID 81496704) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)-N-(3-bromo-2-hydroxyphenyl)-5-methylhexanamide.
| Compound Name | (3S)-3-(aminomethyl)-N-(3-bromo-2-hydroxyphenyl)-5-methylhexanamide |
|---|---|
| PubChem CID | 81496704 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (3S)-3-(aminomethyl)-N-(3-bromo-2-hydroxyphenyl)-5-methylhexanamide |
| SMILES | CC(C)C[C@H](CN)CC(=O)Nc1cccc(Br)c1O |
| InChI | InChI=1S/C14H21BrN2O2/c1-9(2)6-10(8-16)7-13(18)17-12-5-3-4-11(15)14(12)19/h3-5,9-10,19H,6-8,16H2,1-2H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | UHUGIDOFJHDMTC-JTQLQIEISA-N |
| XLogP | 3.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|