C10H10FN3O4S2 — CID 116814330
2-[(1-methylimidazol-4-yl)sulfonylamino]benzenesulfonyl fluoride (PubChem CID 116814330) has the molecular formula C10H10FN3O4S2 and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-[(1-methylimidazol-4-yl)sulfonylamino]benzenesulfonyl fluoride.
| Compound Name | 2-[(1-methylimidazol-4-yl)sulfonylamino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 116814330 |
| Molecular Formula | C10H10FN3O4S2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 2-[(1-methylimidazol-4-yl)sulfonylamino]benzenesulfonyl fluoride |
| SMILES | Cn1cnc(S(=O)(=O)Nc2ccccc2S(=O)(=O)F)c1 |
| InChI | InChI=1S/C10H10FN3O4S2/c1-14-6-10(12-7-14)20(17,18)13-8-4-2-3-5-9(8)19(11,15)16/h2-7,13H,1H3 |
| InChIKey | ANDDTHJYYHNWFC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |