About 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid
5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid (PubChem CID 116814491) has the molecular formula C10H17NO5S
and a molecular weight of 263.31 g/mol. Its IUPAC name is 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid.
Analyze 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid?
The IUPAC name of 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid (CID 116814491) is 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid.
What is the SMILES notation for 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid?
The canonical SMILES for 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid is O=C(O)C1CCC(CN2CCCCS2(=O)=O)O1.
What is the InChIKey of 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid?
The InChIKey is KSHVLPHMYOELCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO5S/c12-10(13)9-4-3-8(16-9)7-11-5-1-2-6-17(11,14)15/h8-9H,1-7H2,(H,12,13).
What are the key properties of 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid?
5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid has a molecular weight of 263.31 g/mol, XLogP of 0.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,1-dioxothiazinan-2-yl)methyl]oxolane-2-carboxylic acid is sourced from PubChem (CID 116814491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).