5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid

C9H13NO5 — CID 62299054

IUPAC5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid
SMILESO=C(O)C1CCC(CN2CCOC2=O)O1
InChIInChI=1S/C9H13NO5/c11-8(12)7-2-1-6(15-7)5-10-3-4-14-9(10)13/h6-7H,1-5H2,(H,11,12)
InChIKeyJNHKWDRDEUMXHD-UHFFFAOYSA-N
MW215.20 g/mol
LogP0.07
Rot. Bonds3

About 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid

5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid (PubChem CID 62299054) has the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. Its IUPAC name is 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid.

Molecular Properties

Compound Name5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid
PubChem CID62299054
Molecular FormulaC9H13NO5
Molecular Weight215.20 g/mol
Exact Mass215.08
IUPAC Name5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid
SMILESO=C(O)C1CCC(CN2CCOC2=O)O1
InChIInChI=1S/C9H13NO5/c11-8(12)7-2-1-6(15-7)5-10-3-4-14-9(10)13/h6-7H,1-5H2,(H,11,12)
InChIKeyJNHKWDRDEUMXHD-UHFFFAOYSA-N
XLogP0.07
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.20
LogP ≤ 50.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid?
The IUPAC name of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid (CID 62299054) is 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid.
What is the SMILES notation for 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid?
The canonical SMILES for 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid is O=C(O)C1CCC(CN2CCOC2=O)O1.
What is the InChIKey of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid?
The InChIKey is JNHKWDRDEUMXHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO5/c11-8(12)7-2-1-6(15-7)5-10-3-4-14-9(10)13/h6-7H,1-5H2,(H,11,12).
What are the key properties of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid?
5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid has a molecular weight of 215.20 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid is sourced from PubChem (CID 62299054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).