About 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid
5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid (PubChem CID 62299054) has the molecular formula C9H13NO5
and a molecular weight of 215.20 g/mol. Its IUPAC name is 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid.
Analyze 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid?
The IUPAC name of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid (CID 62299054) is 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid.
What is the SMILES notation for 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid?
The canonical SMILES for 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid is O=C(O)C1CCC(CN2CCOC2=O)O1.
What is the InChIKey of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid?
The InChIKey is JNHKWDRDEUMXHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO5/c11-8(12)7-2-1-6(15-7)5-10-3-4-14-9(10)13/h6-7H,1-5H2,(H,11,12).
What are the key properties of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid?
5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid has a molecular weight of 215.20 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]oxolane-2-carboxylic acid is sourced from PubChem (CID 62299054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).