C21H20N2O2 — CID 11681510
[8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] prop-2-enoate (PubChem CID 11681510) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is [8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] prop-2-enoate.
| Compound Name | [8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11681510 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | [8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CC2CCC(C1)N2c1ccc(C#N)c2ccccc12 |
| InChI | InChI=1S/C21H20N2O2/c1-2-21(24)25-17-11-15-8-9-16(12-17)23(15)20-10-7-14(13-22)18-5-3-4-6-19(18)20/h2-7,10,15-17H,1,8-9,11-12H2 |
| InChIKey | FGIKOFSBYOXCQR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|