C12H19ClN2O4S — CID 116815594
4-chloro-N-[6-(2-methoxyethoxy)-3-pyridinyl]butane-1-sulfonamide (PubChem CID 116815594) has the molecular formula C12H19ClN2O4S and a molecular weight of 322.81 g/mol. Its IUPAC name is 4-chloro-N-[6-(2-methoxyethoxy)-3-pyridinyl]butane-1-sulfonamide.
| Compound Name | 4-chloro-N-[6-(2-methoxyethoxy)-3-pyridinyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 116815594 |
| Molecular Formula | C12H19ClN2O4S |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-chloro-N-[6-(2-methoxyethoxy)-3-pyridinyl]butane-1-sulfonamide |
| SMILES | COCCOc1ccc(NS(=O)(=O)CCCCCl)cn1 |
| InChI | InChI=1S/C12H19ClN2O4S/c1-18-7-8-19-12-5-4-11(10-14-12)15-20(16,17)9-3-2-6-13/h4-5,10,15H,2-3,6-9H2,1H3 |
| InChIKey | LEDOKOCWLMRYMU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|