C10H5Cl2N3 — CID 116818304
1-(2,3-dichlorophenyl)pyrazole-3-carbonitrile (PubChem CID 116818304) has the molecular formula C10H5Cl2N3 and a molecular weight of 238.08 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)pyrazole-3-carbonitrile.
| Compound Name | 1-(2,3-dichlorophenyl)pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 116818304 |
| Molecular Formula | C10H5Cl2N3 |
| Molecular Weight | 238.08 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 1-(2,3-dichlorophenyl)pyrazole-3-carbonitrile |
| SMILES | N#Cc1ccn(-c2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C10H5Cl2N3/c11-8-2-1-3-9(10(8)12)15-5-4-7(6-13)14-15/h1-5H |
| InChIKey | LNGQYJZXMXEQIL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.08 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |