C11H7N5 — CID 140748755
1-imidazo[1,2-a]pyridin-2-ylpyrazole-3-carbonitrile (PubChem CID 140748755) has the molecular formula C11H7N5 and a molecular weight of 209.21 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyridin-2-ylpyrazole-3-carbonitrile.
| Compound Name | 1-imidazo[1,2-a]pyridin-2-ylpyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 140748755 |
| Molecular Formula | C11H7N5 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-imidazo[1,2-a]pyridin-2-ylpyrazole-3-carbonitrile |
| SMILES | N#Cc1ccn(-c2cn3ccccc3n2)n1 |
| InChI | InChI=1S/C11H7N5/c12-7-9-4-6-16(14-9)11-8-15-5-2-1-3-10(15)13-11/h1-6,8H |
| InChIKey | RIVVTKQTDYGIST-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |