C7H5FN2 — CID 68592134
2-fluoroimidazo[1,2-a]pyridine (PubChem CID 68592134) has the molecular formula C7H5FN2 and a molecular weight of 136.13 g/mol. Its IUPAC name is 2-fluoroimidazo[1,2-a]pyridine.
| Compound Name | 2-fluoroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 68592134 |
| Molecular Formula | C7H5FN2 |
| Molecular Weight | 136.13 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 2-fluoroimidazo[1,2-a]pyridine |
| SMILES | Fc1cn2ccccc2n1 |
| InChI | InChI=1S/C7H5FN2/c8-6-5-10-4-2-1-3-7(10)9-6/h1-5H |
| InChIKey | VXKIAXALJYPFHT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.13 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |