About N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine
N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine (PubChem CID 91122576) has the molecular formula C10H10FN3
and a molecular weight of 191.21 g/mol. Its IUPAC name is N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine |
| PubChem CID | 91122576 |
| Molecular Formula | C10H10FN3 |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine |
| SMILES | FN(c1cn2ccccc2n1)C1CC1 |
| InChI | InChI=1S/C10H10FN3/c11-14(8-4-5-8)10-7-13-6-2-1-3-9(13)12-10/h1-3,6-8H,4-5H2 |
| InChIKey | TXQZBRNJLAXPHU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine?
The IUPAC name of N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine (CID 91122576) is N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine.
What is the SMILES notation for N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine?
The canonical SMILES for N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine is FN(c1cn2ccccc2n1)C1CC1.
What is the InChIKey of N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine?
The InChIKey is TXQZBRNJLAXPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN3/c11-14(8-4-5-8)10-7-13-6-2-1-3-9(13)12-10/h1-3,6-8H,4-5H2.
What are the key properties of N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine?
N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine has a molecular weight of 191.21 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-fluoroimidazo[1,2-a]pyridin-2-amine is sourced from PubChem (CID 91122576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).